C22H30N4O5 — CID 122642090
tert-butyl 4-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-nitroanilino]methyl]piperidine-1-carboxylate (PubChem CID 122642090) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is tert-butyl 4-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-nitroanilino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-nitroanilino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122642090 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | tert-butyl 4-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-nitroanilino]methyl]piperidine-1-carboxylate |
| SMILES | Cc1noc(C)c1-c1ccc(NCC2CCN(C(=O)OC(C)(C)C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H30N4O5/c1-14-20(15(2)31-24-14)17-6-7-18(19(12-17)26(28)29)23-13-16-8-10-25(11-9-16)21(27)30-22(3,4)5/h6-7,12,16,23H,8-11,13H2,1-5H3 |
| InChIKey | FFAKOEAPHBCNOM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|