C23H26Cl2N4O2 — CID 76782563
tert-butyl 3-[[[2-chloro-5-[2-(2-chlorophenyl)ethynyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carboxylate (PubChem CID 76782563) has the molecular formula C23H26Cl2N4O2 and a molecular weight of 461.39 g/mol. Its IUPAC name is tert-butyl 3-[[[2-chloro-5-[2-(2-chlorophenyl)ethynyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[2-chloro-5-[2-(2-chlorophenyl)ethynyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 76782563 |
| Molecular Formula | C23H26Cl2N4O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | tert-butyl 3-[[[2-chloro-5-[2-(2-chlorophenyl)ethynyl]pyrimidin-4-yl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CNc2nc(Cl)ncc2C#Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C23H26Cl2N4O2/c1-23(2,3)31-22(30)29-12-6-7-16(15-29)13-26-20-18(14-27-21(25)28-20)11-10-17-8-4-5-9-19(17)24/h4-5,8-9,14,16H,6-7,12-13,15H2,1-3H3,(H,26,27,28) |
| InChIKey | QCKPTMDOFAOTNB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|