C17H30N6O4 — CID 140821913
tert-butyl N-[1-[[2-(tert-butylamino)-5-nitropyrimidin-4-yl]amino]-2-methylpropan-2-yl]carbamate (PubChem CID 140821913) has the molecular formula C17H30N6O4 and a molecular weight of 382.47 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(tert-butylamino)-5-nitropyrimidin-4-yl]amino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(tert-butylamino)-5-nitropyrimidin-4-yl]amino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 140821913 |
| Molecular Formula | C17H30N6O4 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | tert-butyl N-[1-[[2-(tert-butylamino)-5-nitropyrimidin-4-yl]amino]-2-methylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)Nc1ncc([N+](=O)[O-])c(NCC(C)(C)NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C17H30N6O4/c1-15(2,3)21-13-18-9-11(23(25)26)12(20-13)19-10-17(7,8)22-14(24)27-16(4,5)6/h9H,10H2,1-8H3,(H,22,24)(H2,18,19,20,21) |
| InChIKey | RVFNANKEROKGMC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|