C10H17N7O3 — CID 106280909
3-[(2-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106280909) has the molecular formula C10H17N7O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(2-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106280909 |
| Molecular Formula | C10H17N7O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-[(2-hydrazinyl-5-nitropyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1nc(NN)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H17N7O3/c1-10(2,8(18)12-3)5-14-7-6(17(19)20)4-13-9(15-7)16-11/h4H,5,11H2,1-3H3,(H,12,18)(H2,13,14,15,16) |
| InChIKey | IQEVCTBRLLQYJM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|