C11H20N6O — CID 106280884
3-[(2-hydrazinyl-5-methylpyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106280884) has the molecular formula C11H20N6O and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-5-methylpyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(2-hydrazinyl-5-methylpyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106280884 |
| Molecular Formula | C11H20N6O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 3-[(2-hydrazinyl-5-methylpyrimidin-4-yl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1nc(NN)ncc1C |
| InChI | InChI=1S/C11H20N6O/c1-7-5-14-10(17-12)16-8(7)15-6-11(2,3)9(18)13-4/h5H,6,12H2,1-4H3,(H,13,18)(H2,14,15,16,17) |
| InChIKey | FZGVUHVFANGLBT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|