C11H18N4O2 — CID 106278290
3-[(5-methoxypyrimidin-2-yl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106278290) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-[(5-methoxypyrimidin-2-yl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(5-methoxypyrimidin-2-yl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106278290 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3-[(5-methoxypyrimidin-2-yl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1ncc(OC)cn1 |
| InChI | InChI=1S/C11H18N4O2/c1-11(2,9(16)12-3)7-15-10-13-5-8(17-4)6-14-10/h5-6H,7H2,1-4H3,(H,12,16)(H,13,14,15) |
| InChIKey | SIUOUBVBPNOYQB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |