C10H15ClN4O — CID 103823329
3-[(5-chloropyrimidin-2-yl)amino]-N,2,2-trimethylpropanamide (PubChem CID 103823329) has the molecular formula C10H15ClN4O and a molecular weight of 242.71 g/mol. Its IUPAC name is 3-[(5-chloropyrimidin-2-yl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(5-chloropyrimidin-2-yl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 103823329 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-[(5-chloropyrimidin-2-yl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1ncc(Cl)cn1 |
| InChI | InChI=1S/C10H15ClN4O/c1-10(2,8(16)12-3)6-15-9-13-4-7(11)5-14-9/h4-5H,6H2,1-3H3,(H,12,16)(H,13,14,15) |
| InChIKey | MIKRFPRMWXJWQW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |