C10H15N3O2 — CID 115427683
2,2-dimethyl-3-[(5-methylpyrimidin-2-yl)amino]propanoic acid (PubChem CID 115427683) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(5-methylpyrimidin-2-yl)amino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[(5-methylpyrimidin-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 115427683 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2,2-dimethyl-3-[(5-methylpyrimidin-2-yl)amino]propanoic acid |
| SMILES | Cc1cnc(NCC(C)(C)C(=O)O)nc1 |
| InChI | InChI=1S/C10H15N3O2/c1-7-4-11-9(12-5-7)13-6-10(2,3)8(14)15/h4-5H,6H2,1-3H3,(H,14,15)(H,11,12,13) |
| InChIKey | ZDYSMDLXAJOKRC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |