C15H25N3O — CID 106278300
3-[(5-tert-butyl-2-pyridinyl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106278300) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-[(5-tert-butyl-2-pyridinyl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(5-tert-butyl-2-pyridinyl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106278300 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 3-[(5-tert-butyl-2-pyridinyl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1ccc(C(C)(C)C)cn1 |
| InChI | InChI=1S/C15H25N3O/c1-14(2,3)11-7-8-12(17-9-11)18-10-15(4,5)13(19)16-6/h7-9H,10H2,1-6H3,(H,16,19)(H,17,18) |
| InChIKey | YOVKPIKVSCEADO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |