C11H19N5O — CID 106275362
3-[(5,6-diamino-2-pyridinyl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106275362) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 3-[(5,6-diamino-2-pyridinyl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(5,6-diamino-2-pyridinyl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106275362 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 3-[(5,6-diamino-2-pyridinyl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C11H19N5O/c1-11(2,10(17)14-3)6-15-8-5-4-7(12)9(13)16-8/h4-5H,6,12H2,1-3H3,(H,14,17)(H3,13,15,16) |
| InChIKey | SZHDHCPQAFRORX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |