C9H15N5O — CID 79825795
2-[(5,6-diamino-2-pyridinyl)amino]-N,N-dimethylacetamide (PubChem CID 79825795) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[(5,6-diamino-2-pyridinyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[(5,6-diamino-2-pyridinyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 79825795 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-[(5,6-diamino-2-pyridinyl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C9H15N5O/c1-14(2)8(15)5-12-7-4-3-6(10)9(11)13-7/h3-4H,5,10H2,1-2H3,(H3,11,12,13) |
| InChIKey | PHLXGHDRTZTPLG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |