C10H15N3O — CID 43310935
2-(2-aminoanilino)-N,N-dimethylacetamide (PubChem CID 43310935) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(2-aminoanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(2-aminoanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43310935 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-(2-aminoanilino)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1ccccc1N |
| InChI | InChI=1S/C10H15N3O/c1-13(2)10(14)7-12-9-6-4-3-5-8(9)11/h3-6,12H,7,11H2,1-2H3 |
| InChIKey | PFPYFLCFGRVRSJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|