C16H17ClN2O3S — CID 20851212
2-[2-(4-chlorophenyl)sulfonylanilino]-N,N-dimethylacetamide (PubChem CID 20851212) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfonylanilino]-N,N-dimethylacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)sulfonylanilino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 20851212 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfonylanilino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1ccccc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-19(2)16(20)11-18-14-5-3-4-6-15(14)23(21,22)13-9-7-12(17)8-10-13/h3-10,18H,11H2,1-2H3 |
| InChIKey | ADATWWHBRPSWDV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |