C20H15Cl2NO4S — CID 20851016
(2,4-dichlorophenyl) 2-[2-(benzenesulfonyl)anilino]acetate (PubChem CID 20851016) has the molecular formula C20H15Cl2NO4S and a molecular weight of 436.32 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 2-[2-(benzenesulfonyl)anilino]acetate.
| Compound Name | (2,4-dichlorophenyl) 2-[2-(benzenesulfonyl)anilino]acetate |
|---|---|
| PubChem CID | 20851016 |
| Molecular Formula | C20H15Cl2NO4S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | (2,4-dichlorophenyl) 2-[2-(benzenesulfonyl)anilino]acetate |
| SMILES | O=C(CNc1ccccc1S(=O)(=O)c1ccccc1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl2NO4S/c21-14-10-11-18(16(22)12-14)27-20(24)13-23-17-8-4-5-9-19(17)28(25,26)15-6-2-1-3-7-15/h1-12,23H,13H2 |
| InChIKey | NCXQWURKQJZKHO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|