C19H13Cl2NO4S — CID 142402098
phenyl N-[4-(2,4-dichlorophenyl)sulfonylphenyl]carbamate (PubChem CID 142402098) has the molecular formula C19H13Cl2NO4S and a molecular weight of 422.29 g/mol. Its IUPAC name is phenyl N-[4-(2,4-dichlorophenyl)sulfonylphenyl]carbamate.
| Compound Name | phenyl N-[4-(2,4-dichlorophenyl)sulfonylphenyl]carbamate |
|---|---|
| PubChem CID | 142402098 |
| Molecular Formula | C19H13Cl2NO4S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | phenyl N-[4-(2,4-dichlorophenyl)sulfonylphenyl]carbamate |
| SMILES | O=C(Nc1ccc(S(=O)(=O)c2ccc(Cl)cc2Cl)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C19H13Cl2NO4S/c20-13-6-11-18(17(21)12-13)27(24,25)16-9-7-14(8-10-16)22-19(23)26-15-4-2-1-3-5-15/h1-12H,(H,22,23) |
| InChIKey | VAJMRTKNLWYVNY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |