C19H18ClNO4S — CID 172555120
phenyl N-[4-chloro-3-(3-methyl-3-methylsulfonylbut-1-ynyl)phenyl]carbamate (PubChem CID 172555120) has the molecular formula C19H18ClNO4S and a molecular weight of 391.88 g/mol. Its IUPAC name is phenyl N-[4-chloro-3-(3-methyl-3-methylsulfonylbut-1-ynyl)phenyl]carbamate.
| Compound Name | phenyl N-[4-chloro-3-(3-methyl-3-methylsulfonylbut-1-ynyl)phenyl]carbamate |
|---|---|
| PubChem CID | 172555120 |
| Molecular Formula | C19H18ClNO4S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | phenyl N-[4-chloro-3-(3-methyl-3-methylsulfonylbut-1-ynyl)phenyl]carbamate |
| SMILES | CC(C)(C#Cc1cc(NC(=O)Oc2ccccc2)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C19H18ClNO4S/c1-19(2,26(3,23)24)12-11-14-13-15(9-10-17(14)20)21-18(22)25-16-7-5-4-6-8-16/h4-10,13H,1-3H3,(H,21,22) |
| InChIKey | IBTXQUHUILGFPL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|