3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid

C14H9Cl2NO4 — CID 82811858

IUPAC3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid
SMILESO=C(Nc1c(Cl)cc(C(=O)O)cc1Cl)Oc1ccccc1
InChIInChI=1S/C14H9Cl2NO4/c15-10-6-8(13(18)19)7-11(16)12(10)17-14(20)21-9-4-2-1-3-5-9/h1-7H,(H,17,20)(H,18,19)
InChIKeyZTLFRRHKTXXFCU-UHFFFAOYSA-N
MW326.14 g/mol
LogP4.30
Rot. Bonds3

About 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid

3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid (PubChem CID 82811858) has the molecular formula C14H9Cl2NO4 and a molecular weight of 326.14 g/mol. Its IUPAC name is 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid.

Molecular Properties

Compound Name3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid
PubChem CID82811858
Molecular FormulaC14H9Cl2NO4
Molecular Weight326.14 g/mol
Exact Mass324.99
IUPAC Name3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid
SMILESO=C(Nc1c(Cl)cc(C(=O)O)cc1Cl)Oc1ccccc1
InChIInChI=1S/C14H9Cl2NO4/c15-10-6-8(13(18)19)7-11(16)12(10)17-14(20)21-9-4-2-1-3-5-9/h1-7H,(H,17,20)(H,18,19)
InChIKeyZTLFRRHKTXXFCU-UHFFFAOYSA-N
XLogP4.30
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.14
LogP ≤ 54.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid?
The IUPAC name of 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid (CID 82811858) is 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid.
What is the SMILES notation for 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid?
The canonical SMILES for 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid is O=C(Nc1c(Cl)cc(C(=O)O)cc1Cl)Oc1ccccc1.
What is the InChIKey of 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid?
The InChIKey is ZTLFRRHKTXXFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2NO4/c15-10-6-8(13(18)19)7-11(16)12(10)17-14(20)21-9-4-2-1-3-5-9/h1-7H,(H,17,20)(H,18,19).
What are the key properties of 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid?
3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid has a molecular weight of 326.14 g/mol, XLogP of 4.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-(phenoxycarbonylamino)benzoic acid is sourced from PubChem (CID 82811858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).