C21H14Cl2N2O6 — CID 67542680
3,5-bis[(4-chlorophenoxy)carbonylamino]benzoic acid (PubChem CID 67542680) has the molecular formula C21H14Cl2N2O6 and a molecular weight of 461.26 g/mol. Its IUPAC name is 3,5-bis[(4-chlorophenoxy)carbonylamino]benzoic acid.
| Compound Name | 3,5-bis[(4-chlorophenoxy)carbonylamino]benzoic acid |
|---|---|
| PubChem CID | 67542680 |
| Molecular Formula | C21H14Cl2N2O6 |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 3,5-bis[(4-chlorophenoxy)carbonylamino]benzoic acid |
| SMILES | O=C(Nc1cc(NC(=O)Oc2ccc(Cl)cc2)cc(C(=O)O)c1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O6/c22-13-1-5-17(6-2-13)30-20(28)24-15-9-12(19(26)27)10-16(11-15)25-21(29)31-18-7-3-14(23)4-8-18/h1-11H,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | SAHXPDXQDXBCRA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |