C17H12ClN3O3 — CID 70516403
(4-chlorophenyl) N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate (PubChem CID 70516403) has the molecular formula C17H12ClN3O3 and a molecular weight of 341.75 g/mol. Its IUPAC name is (4-chlorophenyl) N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate.
| Compound Name | (4-chlorophenyl) N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70516403 |
| Molecular Formula | C17H12ClN3O3 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (4-chlorophenyl) N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(-c2ccc(=O)[nH]n2)cc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClN3O3/c18-12-3-7-14(8-4-12)24-17(23)19-13-5-1-11(2-6-13)15-9-10-16(22)21-20-15/h1-10H,(H,19,23)(H,21,22) |
| InChIKey | ISOPAKMTGBMIIB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |