C18H12N4O3 — CID 70518559
(4-cyanophenyl) N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate (PubChem CID 70518559) has the molecular formula C18H12N4O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is (4-cyanophenyl) N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate.
| Compound Name | (4-cyanophenyl) N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70518559 |
| Molecular Formula | C18H12N4O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (4-cyanophenyl) N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
| SMILES | N#Cc1ccc(OC(=O)Nc2ccc(-c3ccc(=O)[nH]n3)cc2)cc1 |
| InChI | InChI=1S/C18H12N4O3/c19-11-12-1-7-15(8-2-12)25-18(24)20-14-5-3-13(4-6-14)16-9-10-17(23)22-21-16/h1-10H,(H,20,24)(H,22,23) |
| InChIKey | ACRDAKVKSYGQND-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |