C14H11N3O2S — CID 88729986
S-prop-2-ynyl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamothioate (PubChem CID 88729986) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is S-prop-2-ynyl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamothioate.
| Compound Name | S-prop-2-ynyl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamothioate |
|---|---|
| PubChem CID | 88729986 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | S-prop-2-ynyl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamothioate |
| SMILES | C#CCSC(=O)Nc1ccc(-c2ccc(=O)[nH]n2)cc1 |
| InChI | InChI=1S/C14H11N3O2S/c1-2-9-20-14(19)15-11-5-3-10(4-6-11)12-7-8-13(18)17-16-12/h1,3-8H,9H2,(H,15,19)(H,17,18) |
| InChIKey | JTULJTXWIHFWBA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|