C15H15N3O3 — CID 70516961
cyclobutyl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate (PubChem CID 70516961) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is cyclobutyl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate.
| Compound Name | cyclobutyl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70516961 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | cyclobutyl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(-c2ccc(=O)[nH]n2)cc1)OC1CCC1 |
| InChI | InChI=1S/C15H15N3O3/c19-14-9-8-13(17-18-14)10-4-6-11(7-5-10)16-15(20)21-12-2-1-3-12/h4-9,12H,1-3H2,(H,16,20)(H,18,19) |
| InChIKey | WECYNBQUXXZUHF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |