C15H16ClN3O3 — CID 70517104
1-chlorobutan-2-yl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate (PubChem CID 70517104) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is 1-chlorobutan-2-yl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate.
| Compound Name | 1-chlorobutan-2-yl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 70517104 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-chlorobutan-2-yl N-[4-(6-oxo-1H-pyridazin-3-yl)phenyl]carbamate |
| SMILES | CCC(CCl)OC(=O)Nc1ccc(-c2ccc(=O)[nH]n2)cc1 |
| InChI | InChI=1S/C15H16ClN3O3/c1-2-12(9-16)22-15(21)17-11-5-3-10(4-6-11)13-7-8-14(20)19-18-13/h3-8,12H,2,9H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | PXUVINUIAVYPLW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|