C28H24N2O6S — CID 5112420
[4-[4-[(4-methylphenyl)carbamoyloxy]phenyl]sulfonylphenyl] N-(4-methylphenyl)carbamate (PubChem CID 5112420) has the molecular formula C28H24N2O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is [4-[4-[(4-methylphenyl)carbamoyloxy]phenyl]sulfonylphenyl] N-(4-methylphenyl)carbamate.
| Compound Name | [4-[4-[(4-methylphenyl)carbamoyloxy]phenyl]sulfonylphenyl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 5112420 |
| Molecular Formula | C28H24N2O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | [4-[4-[(4-methylphenyl)carbamoyloxy]phenyl]sulfonylphenyl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)Oc2ccc(S(=O)(=O)c3ccc(OC(=O)Nc4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H24N2O6S/c1-19-3-7-21(8-4-19)29-27(31)35-23-11-15-25(16-12-23)37(33,34)26-17-13-24(14-18-26)36-28(32)30-22-9-5-20(2)6-10-22/h3-18H,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | COCZWBJQLQMQKM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |