C19H17NO3S2 — CID 53124608
N-(4-methylphenyl)-5-(4-methylphenyl)sulfonylthiophene-2-carboxamide (PubChem CID 53124608) has the molecular formula C19H17NO3S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-(4-methylphenyl)-5-(4-methylphenyl)sulfonylthiophene-2-carboxamide.
| Compound Name | N-(4-methylphenyl)-5-(4-methylphenyl)sulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 53124608 |
| Molecular Formula | C19H17NO3S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-(4-methylphenyl)-5-(4-methylphenyl)sulfonylthiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(S(=O)(=O)c3ccc(C)cc3)s2)cc1 |
| InChI | InChI=1S/C19H17NO3S2/c1-13-3-7-15(8-4-13)20-19(21)17-11-12-18(24-17)25(22,23)16-9-5-14(2)6-10-16/h3-12H,1-2H3,(H,20,21) |
| InChIKey | VHIUKMXDRNSXIT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |