C12H13N3O5S3 — CID 76852481
1-methyl-3-[4-(5-sulfamoylthiophen-2-yl)sulfonylphenyl]urea (PubChem CID 76852481) has the molecular formula C12H13N3O5S3 and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-methyl-3-[4-(5-sulfamoylthiophen-2-yl)sulfonylphenyl]urea.
| Compound Name | 1-methyl-3-[4-(5-sulfamoylthiophen-2-yl)sulfonylphenyl]urea |
|---|---|
| PubChem CID | 76852481 |
| Molecular Formula | C12H13N3O5S3 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 1-methyl-3-[4-(5-sulfamoylthiophen-2-yl)sulfonylphenyl]urea |
| SMILES | CNC(=O)Nc1ccc(S(=O)(=O)c2ccc(S(N)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C12H13N3O5S3/c1-14-12(16)15-8-2-4-9(5-3-8)22(17,18)10-6-7-11(21-10)23(13,19)20/h2-7H,1H3,(H2,13,19,20)(H2,14,15,16) |
| InChIKey | ZFCYPXHHSYJCAE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |