C18H16N2O5S3 — CID 2814518
N-[4-[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]acetamide (PubChem CID 2814518) has the molecular formula C18H16N2O5S3 and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[4-[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]acetamide.
| Compound Name | N-[4-[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 2814518 |
| Molecular Formula | C18H16N2O5S3 |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | N-[4-[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NS(=O)(=O)c2ccc(S(=O)(=O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C18H16N2O5S3/c1-13(21)19-14-7-9-15(10-8-14)20-28(24,25)18-12-11-17(26-18)27(22,23)16-5-3-2-4-6-16/h2-12,20H,1H3,(H,19,21) |
| InChIKey | DUPLDEZUFPLKPT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |