C16H14N2O6S4 — CID 5097147
5-(benzenesulfonyl)-N-(3-sulfamoylphenyl)thiophene-2-sulfonamide (PubChem CID 5097147) has the molecular formula C16H14N2O6S4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N-(3-sulfamoylphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-(benzenesulfonyl)-N-(3-sulfamoylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 5097147 |
| Molecular Formula | C16H14N2O6S4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 5-(benzenesulfonyl)-N-(3-sulfamoylphenyl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NS(=O)(=O)c2ccc(S(=O)(=O)c3ccccc3)s2)c1 |
| InChI | InChI=1S/C16H14N2O6S4/c17-27(21,22)14-8-4-5-12(11-14)18-28(23,24)16-10-9-15(25-16)26(19,20)13-6-2-1-3-7-13/h1-11,18H,(H2,17,21,22) |
| InChIKey | SILBZNJMMWTXRK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |