C9H8ClN3O4S3 — CID 43427451
2-chloro-N-(3-sulfamoylphenyl)-1,3-thiazole-5-sulfonamide (PubChem CID 43427451) has the molecular formula C9H8ClN3O4S3 and a molecular weight of 353.83 g/mol. Its IUPAC name is 2-chloro-N-(3-sulfamoylphenyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(3-sulfamoylphenyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43427451 |
| Molecular Formula | C9H8ClN3O4S3 |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 2-chloro-N-(3-sulfamoylphenyl)-1,3-thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NS(=O)(=O)c2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C9H8ClN3O4S3/c10-9-12-5-8(18-9)20(16,17)13-6-2-1-3-7(4-6)19(11,14)15/h1-5,13H,(H2,11,14,15) |
| InChIKey | FNXGJCQOMGGNCH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |