C9H4Cl3FN2O2S2 — CID 107573403
2-chloro-N-(3,5-dichloro-4-fluorophenyl)-1,3-thiazole-5-sulfonamide (PubChem CID 107573403) has the molecular formula C9H4Cl3FN2O2S2 and a molecular weight of 361.63 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloro-4-fluorophenyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 107573403 |
| Molecular Formula | C9H4Cl3FN2O2S2 |
| Molecular Weight | 361.63 g/mol |
| Exact Mass | 359.88 |
| IUPAC Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(F)c(Cl)c1)c1cnc(Cl)s1 |
| InChI | InChI=1S/C9H4Cl3FN2O2S2/c10-5-1-4(2-6(11)8(5)13)15-19(16,17)7-3-14-9(12)18-7/h1-3,15H |
| InChIKey | IBDPYLKPLDZRJA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|