C11H9ClN2O4S2 — CID 60749436
methyl 4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]benzoate (PubChem CID 60749436) has the molecular formula C11H9ClN2O4S2 and a molecular weight of 332.79 g/mol. Its IUPAC name is methyl 4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]benzoate.
| Compound Name | methyl 4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 60749436 |
| Molecular Formula | C11H9ClN2O4S2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | methyl 4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C11H9ClN2O4S2/c1-18-10(15)7-2-4-8(5-3-7)14-20(16,17)9-6-13-11(12)19-9/h2-6,14H,1H3 |
| InChIKey | WKPBBZVFJBALFY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |