C12H12ClN3O3S2 — CID 60749460
4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylbenzamide (PubChem CID 60749460) has the molecular formula C12H12ClN3O3S2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 60749460 |
| Molecular Formula | C12H12ClN3O3S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NS(=O)(=O)c2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C12H12ClN3O3S2/c1-16(2)11(17)8-3-5-9(6-4-8)15-21(18,19)10-7-14-12(13)20-10/h3-7,15H,1-2H3 |
| InChIKey | WBQFUUDIKBUCKM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |