C9H13N3O3S — CID 112573421
N,N-dimethyl-4-(sulfamoylamino)benzamide (PubChem CID 112573421) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is N,N-dimethyl-4-(sulfamoylamino)benzamide.
| Compound Name | N,N-dimethyl-4-(sulfamoylamino)benzamide |
|---|---|
| PubChem CID | 112573421 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N,N-dimethyl-4-(sulfamoylamino)benzamide |
| SMILES | CN(C)C(=O)c1ccc(NS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C9H13N3O3S/c1-12(2)9(13)7-3-5-8(6-4-7)11-16(10,14)15/h3-6,11H,1-2H3,(H2,10,14,15) |
| InChIKey | LNTPHRQACNRVKD-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |