C15H15FN2O3S — CID 24580823
4-[(2-fluorophenyl)sulfonylamino]-N,N-dimethylbenzamide (PubChem CID 24580823) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)sulfonylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[(2-fluorophenyl)sulfonylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 24580823 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[(2-fluorophenyl)sulfonylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NS(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C15H15FN2O3S/c1-18(2)15(19)11-7-9-12(10-8-11)17-22(20,21)14-6-4-3-5-13(14)16/h3-10,17H,1-2H3 |
| InChIKey | XCJJWLRMNAPUOC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |