C12H9ClN4O2S2 — CID 61047553
2-chloro-N-[4-(1H-pyrazol-5-yl)phenyl]-1,3-thiazole-5-sulfonamide (PubChem CID 61047553) has the molecular formula C12H9ClN4O2S2 and a molecular weight of 340.82 g/mol. Its IUPAC name is 2-chloro-N-[4-(1H-pyrazol-5-yl)phenyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-[4-(1H-pyrazol-5-yl)phenyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61047553 |
| Molecular Formula | C12H9ClN4O2S2 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2-chloro-N-[4-(1H-pyrazol-5-yl)phenyl]-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2ccn[nH]2)cc1)c1cnc(Cl)s1 |
| InChI | InChI=1S/C12H9ClN4O2S2/c13-12-14-7-11(20-12)21(18,19)17-9-3-1-8(2-4-9)10-5-6-15-16-10/h1-7,17H,(H,15,16) |
| InChIKey | AEHGEQGPLOWQBB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |