C10H7Br2ClN2O2S2 — CID 43455933
2-chloro-N-(2,6-dibromo-4-methylphenyl)-1,3-thiazole-5-sulfonamide (PubChem CID 43455933) has the molecular formula C10H7Br2ClN2O2S2 and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dibromo-4-methylphenyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(2,6-dibromo-4-methylphenyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43455933 |
| Molecular Formula | C10H7Br2ClN2O2S2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 443.80 |
| IUPAC Name | 2-chloro-N-(2,6-dibromo-4-methylphenyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)c2cnc(Cl)s2)c(Br)c1 |
| InChI | InChI=1S/C10H7Br2ClN2O2S2/c1-5-2-6(11)9(7(12)3-5)15-19(16,17)8-4-14-10(13)18-8/h2-4,15H,1H3 |
| InChIKey | MAOGRJDODIITRL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |