C9H5Cl2IN2O2S2 — CID 114259497
2-chloro-N-(2-chloro-5-iodophenyl)-1,3-thiazole-5-sulfonamide (PubChem CID 114259497) has the molecular formula C9H5Cl2IN2O2S2 and a molecular weight of 435.10 g/mol. Its IUPAC name is 2-chloro-N-(2-chloro-5-iodophenyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(2-chloro-5-iodophenyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 114259497 |
| Molecular Formula | C9H5Cl2IN2O2S2 |
| Molecular Weight | 435.10 g/mol |
| Exact Mass | 433.82 |
| IUPAC Name | 2-chloro-N-(2-chloro-5-iodophenyl)-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(I)ccc1Cl)c1cnc(Cl)s1 |
| InChI | InChI=1S/C9H5Cl2IN2O2S2/c10-6-2-1-5(12)3-7(6)14-18(15,16)8-4-13-9(11)17-8/h1-4,14H |
| InChIKey | UIIMENHCMZSJQJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.10 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|