C11H10ClN3O2S3 — CID 103414697
4-chloro-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzenecarbothioamide (PubChem CID 103414697) has the molecular formula C11H10ClN3O2S3 and a molecular weight of 347.87 g/mol. Its IUPAC name is 4-chloro-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzenecarbothioamide.
| Compound Name | 4-chloro-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 103414697 |
| Molecular Formula | C11H10ClN3O2S3 |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 4-chloro-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzenecarbothioamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2cc(C(N)=S)ccc2Cl)s1 |
| InChI | InChI=1S/C11H10ClN3O2S3/c1-6-14-5-10(19-6)20(16,17)15-9-4-7(11(13)18)2-3-8(9)12/h2-5,15H,1H3,(H2,13,18) |
| InChIKey | HHYSNMMVFZAVJE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|