C10H9BrClN5O2S2 — CID 106466568
3-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-chlorobenzenecarbothioamide (PubChem CID 106466568) has the molecular formula C10H9BrClN5O2S2 and a molecular weight of 410.71 g/mol. Its IUPAC name is 3-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-chlorobenzenecarbothioamide.
| Compound Name | 3-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 106466568 |
| Molecular Formula | C10H9BrClN5O2S2 |
| Molecular Weight | 410.71 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | 3-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-chlorobenzenecarbothioamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)Nc1cc(C(N)=S)ccc1Cl |
| InChI | InChI=1S/C10H9BrClN5O2S2/c1-17-10(8(11)14-16-17)21(18,19)15-7-4-5(9(13)20)2-3-6(7)12/h2-4,15H,1H3,(H2,13,20) |
| InChIKey | PJTIOXPFQJZNLH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.71 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|