C11H14BrN5O2S — CID 106465497
N-(6-amino-2,3-dimethylphenyl)-5-bromo-3-methyltriazole-4-sulfonamide (PubChem CID 106465497) has the molecular formula C11H14BrN5O2S and a molecular weight of 360.24 g/mol. Its IUPAC name is N-(6-amino-2,3-dimethylphenyl)-5-bromo-3-methyltriazole-4-sulfonamide.
| Compound Name | N-(6-amino-2,3-dimethylphenyl)-5-bromo-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 106465497 |
| Molecular Formula | C11H14BrN5O2S |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | N-(6-amino-2,3-dimethylphenyl)-5-bromo-3-methyltriazole-4-sulfonamide |
| SMILES | Cc1ccc(N)c(NS(=O)(=O)c2c(Br)nnn2C)c1C |
| InChI | InChI=1S/C11H14BrN5O2S/c1-6-4-5-8(13)9(7(6)2)15-20(18,19)11-10(12)14-16-17(11)3/h4-5,15H,13H2,1-3H3 |
| InChIKey | FFSDJUGRSQVZJL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|