About 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene
1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene (PubChem CID 114958678) has the molecular formula C8H13N3O2S
and a molecular weight of 215.28 g/mol. Its IUPAC name is 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene.
Molecular Properties
| Compound Name | 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene |
| PubChem CID | 114958678 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene |
| SMILES | Cc1ccc(N)c(NS(N)(=O)=O)c1C |
| InChI | InChI=1S/C8H13N3O2S/c1-5-3-4-7(9)8(6(5)2)11-14(10,12)13/h3-4,11H,9H2,1-2H3,(H2,10,12,13) |
| InChIKey | ZMHHNELQWJCGKB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene?
The IUPAC name of 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene (CID 114958678) is 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene.
What is the SMILES notation for 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene?
The canonical SMILES for 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene is Cc1ccc(N)c(NS(N)(=O)=O)c1C.
What is the InChIKey of 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene?
The InChIKey is ZMHHNELQWJCGKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S/c1-5-3-4-7(9)8(6(5)2)11-14(10,12)13/h3-4,11H,9H2,1-2H3,(H2,10,12,13).
What are the key properties of 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene?
1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene has a molecular weight of 215.28 g/mol, XLogP of 0.50, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3,4-dimethyl-2-(sulfamoylamino)benzene is sourced from PubChem (CID 114958678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).