C9H6BrF3N4O2S — CID 106468063
5-bromo-3-methyl-N-(2,4,6-trifluorophenyl)triazole-4-sulfonamide (PubChem CID 106468063) has the molecular formula C9H6BrF3N4O2S and a molecular weight of 371.14 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(2,4,6-trifluorophenyl)triazole-4-sulfonamide.
| Compound Name | 5-bromo-3-methyl-N-(2,4,6-trifluorophenyl)triazole-4-sulfonamide |
|---|---|
| PubChem CID | 106468063 |
| Molecular Formula | C9H6BrF3N4O2S |
| Molecular Weight | 371.14 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | 5-bromo-3-methyl-N-(2,4,6-trifluorophenyl)triazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)Nc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C9H6BrF3N4O2S/c1-17-9(8(10)14-16-17)20(18,19)15-7-5(12)2-4(11)3-6(7)13/h2-3,15H,1H3 |
| InChIKey | BPELIGRLNOCQLG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.14 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |