C10H9BrN4O5S — CID 106465733
4-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-3-hydroxybenzoic acid (PubChem CID 106465733) has the molecular formula C10H9BrN4O5S and a molecular weight of 377.18 g/mol. Its IUPAC name is 4-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 106465733 |
| Molecular Formula | C10H9BrN4O5S |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 4-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-3-hydroxybenzoic acid |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)Nc1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C10H9BrN4O5S/c1-15-9(8(11)12-14-15)21(19,20)13-6-3-2-5(10(17)18)4-7(6)16/h2-4,13,16H,1H3,(H,17,18) |
| InChIKey | CQTYOXGUPRUOKG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|