C10H13NO7S2 — CID 63244820
3-hydroxy-4-(2-methylsulfonylethylsulfonylamino)benzoic acid (PubChem CID 63244820) has the molecular formula C10H13NO7S2 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-hydroxy-4-(2-methylsulfonylethylsulfonylamino)benzoic acid.
| Compound Name | 3-hydroxy-4-(2-methylsulfonylethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 63244820 |
| Molecular Formula | C10H13NO7S2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3-hydroxy-4-(2-methylsulfonylethylsulfonylamino)benzoic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)Nc1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C10H13NO7S2/c1-19(15,16)4-5-20(17,18)11-8-3-2-7(10(13)14)6-9(8)12/h2-3,6,11-12H,4-5H2,1H3,(H,13,14) |
| InChIKey | YZSKMXGGYRUKQI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|