C11H14N2O6S — CID 60827859
3-hydroxy-4-(morpholin-4-ylsulfonylamino)benzoic acid (PubChem CID 60827859) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-hydroxy-4-(morpholin-4-ylsulfonylamino)benzoic acid.
| Compound Name | 3-hydroxy-4-(morpholin-4-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 60827859 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-hydroxy-4-(morpholin-4-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)N2CCOCC2)c(O)c1 |
| InChI | InChI=1S/C11H14N2O6S/c14-10-7-8(11(15)16)1-2-9(10)12-20(17,18)13-3-5-19-6-4-13/h1-2,7,12,14H,3-6H2,(H,15,16) |
| InChIKey | GKYFHOKJPZJGMM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|