C11H13ClN2O4S — CID 29280963
4-chloro-3-(pyrrolidin-1-ylsulfonylamino)benzoic acid (PubChem CID 29280963) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is 4-chloro-3-(pyrrolidin-1-ylsulfonylamino)benzoic acid.
| Compound Name | 4-chloro-3-(pyrrolidin-1-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 29280963 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-chloro-3-(pyrrolidin-1-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(NS(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C11H13ClN2O4S/c12-9-4-3-8(11(15)16)7-10(9)13-19(17,18)14-5-1-2-6-14/h3-4,7,13H,1-2,5-6H2,(H,15,16) |
| InChIKey | MFVYNOFXFQJCAY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |