C12H15ClN2O4S — CID 61398444
2-chloro-4-(piperidin-1-ylsulfonylamino)benzoic acid (PubChem CID 61398444) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is 2-chloro-4-(piperidin-1-ylsulfonylamino)benzoic acid.
| Compound Name | 2-chloro-4-(piperidin-1-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 61398444 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-chloro-4-(piperidin-1-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)N2CCCCC2)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O4S/c13-11-8-9(4-5-10(11)12(16)17)14-20(18,19)15-6-2-1-3-7-15/h4-5,8,14H,1-3,6-7H2,(H,16,17) |
| InChIKey | AUOSAADLAKCGKD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |