C15H19ClN2O5S — CID 119164224
2-chloro-4-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]benzoic acid (PubChem CID 119164224) has the molecular formula C15H19ClN2O5S and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-chloro-4-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]benzoic acid.
| Compound Name | 2-chloro-4-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 119164224 |
| Molecular Formula | C15H19ClN2O5S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-chloro-4-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]benzoic acid |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)Nc2ccc(C(=O)O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H19ClN2O5S/c1-2-24(22,23)18-7-5-10(6-8-18)14(19)17-11-3-4-12(15(20)21)13(16)9-11/h3-4,9-10H,2,5-8H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | LMDJSKUVXBQLKA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |