C21H24N2O5S — CID 75429385
4-[(1-benzylsulfonylpiperidine-4-carbonyl)amino]-2-methylbenzoic acid (PubChem CID 75429385) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-[(1-benzylsulfonylpiperidine-4-carbonyl)amino]-2-methylbenzoic acid.
| Compound Name | 4-[(1-benzylsulfonylpiperidine-4-carbonyl)amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 75429385 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-[(1-benzylsulfonylpiperidine-4-carbonyl)amino]-2-methylbenzoic acid |
| SMILES | Cc1cc(NC(=O)C2CCN(S(=O)(=O)Cc3ccccc3)CC2)ccc1C(=O)O |
| InChI | InChI=1S/C21H24N2O5S/c1-15-13-18(7-8-19(15)21(25)26)22-20(24)17-9-11-23(12-10-17)29(27,28)14-16-5-3-2-4-6-16/h2-8,13,17H,9-12,14H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | CQBLOOCBULMQKU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |