C11H13ClN2O5S — CID 166208292
2-chloro-4-[(3-methoxyazetidin-1-yl)sulfonylamino]benzoic acid (PubChem CID 166208292) has the molecular formula C11H13ClN2O5S and a molecular weight of 320.75 g/mol. Its IUPAC name is 2-chloro-4-[(3-methoxyazetidin-1-yl)sulfonylamino]benzoic acid.
| Compound Name | 2-chloro-4-[(3-methoxyazetidin-1-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 166208292 |
| Molecular Formula | C11H13ClN2O5S |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-chloro-4-[(3-methoxyazetidin-1-yl)sulfonylamino]benzoic acid |
| SMILES | COC1CN(S(=O)(=O)Nc2ccc(C(=O)O)c(Cl)c2)C1 |
| InChI | InChI=1S/C11H13ClN2O5S/c1-19-8-5-14(6-8)20(17,18)13-7-2-3-9(11(15)16)10(12)4-7/h2-4,8,13H,5-6H2,1H3,(H,15,16) |
| InChIKey | VGJUUHQXYVVAHF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |